C23H24O2S — CID 91428818
4-[2-(8-ethylsulfanyl-5,5-dimethyl-6H-naphthalen-1-yl)ethenyl]benzoic acid (PubChem CID 91428818) has the molecular formula C23H24O2S and a molecular weight of 364.51 g/mol. Its IUPAC name is 4-[2-(8-ethylsulfanyl-5,5-dimethyl-6H-naphthalen-1-yl)ethenyl]benzoic acid.
| Compound Name | 4-[2-(8-ethylsulfanyl-5,5-dimethyl-6H-naphthalen-1-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 91428818 |
| Molecular Formula | C23H24O2S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-[2-(8-ethylsulfanyl-5,5-dimethyl-6H-naphthalen-1-yl)ethenyl]benzoic acid |
| SMILES | CCSC1=CCC(C)(C)c2cccc(C=Cc3ccc(C(=O)O)cc3)c21 |
| InChI | InChI=1S/C23H24O2S/c1-4-26-20-14-15-23(2,3)19-7-5-6-17(21(19)20)11-8-16-9-12-18(13-10-16)22(24)25/h5-14H,4,15H2,1-3H3,(H,24,25) |
| InChIKey | PNQUNROPAPACDG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|