C23H21F3O5S — CID 54384200
methyl 4-[2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate (PubChem CID 54384200) has the molecular formula C23H21F3O5S and a molecular weight of 466.48 g/mol. Its IUPAC name is methyl 4-[2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate.
| Compound Name | methyl 4-[2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 54384200 |
| Molecular Formula | C23H21F3O5S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | methyl 4-[2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(C=Cc2ccc3c(c2)C(OS(=O)(=O)C(F)(F)F)=CCC3(C)C)cc1 |
| InChI | InChI=1S/C23H21F3O5S/c1-22(2)13-12-20(31-32(28,29)23(24,25)26)18-14-16(8-11-19(18)22)5-4-15-6-9-17(10-7-15)21(27)30-3/h4-12,14H,13H2,1-3H3 |
| InChIKey | VCCAQJIGEWOOLB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|