C26H26F4O5S — CID 143065694
ethane;methyl 2-[4-[2-[8,8-dimethyl-5-(trifluoromethylsulfonyloxy)-7H-naphthalen-2-yl]ethynyl]-2-fluorophenyl]acetate (PubChem CID 143065694) has the molecular formula C26H26F4O5S and a molecular weight of 526.55 g/mol. Its IUPAC name is ethane;methyl 2-[4-[2-[8,8-dimethyl-5-(trifluoromethylsulfonyloxy)-7H-naphthalen-2-yl]ethynyl]-2-fluorophenyl]acetate.
| Compound Name | ethane;methyl 2-[4-[2-[8,8-dimethyl-5-(trifluoromethylsulfonyloxy)-7H-naphthalen-2-yl]ethynyl]-2-fluorophenyl]acetate |
|---|---|
| PubChem CID | 143065694 |
| Molecular Formula | C26H26F4O5S |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | ethane;methyl 2-[4-[2-[8,8-dimethyl-5-(trifluoromethylsulfonyloxy)-7H-naphthalen-2-yl]ethynyl]-2-fluorophenyl]acetate |
| SMILES | CC.COC(=O)Cc1ccc(C#Cc2ccc3c(c2)C(C)(C)CC=C3OS(=O)(=O)C(F)(F)F)cc1F |
| InChI | InChI=1S/C24H20F4O5S.C2H6/c1-23(2)11-10-21(33-34(30,31)24(26,27)28)18-9-7-15(12-19(18)23)4-5-16-6-8-17(20(25)13-16)14-22(29)32-3;1-2/h6-10,12-13H,11,14H2,1-3H3;1-2H3 |
| InChIKey | AILVEEBWEJHZSS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|