C28H26O2 — CID 67553733
2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate (PubChem CID 67553733) has the molecular formula C28H26O2 and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate.
| Compound Name | 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate |
|---|---|
| PubChem CID | 67553733 |
| Molecular Formula | C28H26O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate |
| SMILES | Cc1ccc(C2=CCC(C)(C)c3ccc(C=COC(=O)c4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C28H26O2/c1-20-9-12-22(13-10-20)24-15-17-28(2,3)26-14-11-21(19-25(24)26)16-18-30-27(29)23-7-5-4-6-8-23/h4-16,18-19H,17H2,1-3H3 |
| InChIKey | IQUHCIKZYTULNS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|