About 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate
2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate (PubChem CID 67553733) has the molecular formula C28H26O2
and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate.
Molecular Properties
| Compound Name | 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate |
| PubChem CID | 67553733 |
| Molecular Formula | C28H26O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate |
| SMILES | Cc1ccc(C2=CCC(C)(C)c3ccc(C=COC(=O)c4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C28H26O2/c1-20-9-12-22(13-10-20)24-15-17-28(2,3)26-14-11-21(19-25(24)26)16-18-30-27(29)23-7-5-4-6-8-23/h4-16,18-19H,17H2,1-3H3 |
| InChIKey | IQUHCIKZYTULNS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate?
The IUPAC name of 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate (CID 67553733) is 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate.
What is the SMILES notation for 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate?
The canonical SMILES for 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate is Cc1ccc(C2=CCC(C)(C)c3ccc(C=COC(=O)c4ccccc4)cc32)cc1.
What is the InChIKey of 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate?
The InChIKey is IQUHCIKZYTULNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26O2/c1-20-9-12-22(13-10-20)24-15-17-28(2,3)26-14-11-21(19-25(24)26)16-18-30-27(29)23-7-5-4-6-8-23/h4-16,18-19H,17H2,1-3H3.
What are the key properties of 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate?
2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate has a molecular weight of 394.51 g/mol, XLogP of 6.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethenyl benzoate is sourced from PubChem (CID 67553733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).