C24H26O5 — CID 67625063
ethyl 7-(2-benzoyloxyethenyl)-1-hydroxy-4,4-dimethyl-2,3-dihydronaphthalene-1-carboxylate (PubChem CID 67625063) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is ethyl 7-(2-benzoyloxyethenyl)-1-hydroxy-4,4-dimethyl-2,3-dihydronaphthalene-1-carboxylate.
| Compound Name | ethyl 7-(2-benzoyloxyethenyl)-1-hydroxy-4,4-dimethyl-2,3-dihydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 67625063 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | ethyl 7-(2-benzoyloxyethenyl)-1-hydroxy-4,4-dimethyl-2,3-dihydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1(O)CCC(C)(C)c2ccc(C=COC(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C24H26O5/c1-4-28-22(26)24(27)14-13-23(2,3)19-11-10-17(16-20(19)24)12-15-29-21(25)18-8-6-5-7-9-18/h5-12,15-16,27H,4,13-14H2,1-3H3 |
| InChIKey | WQYWDVUPOWJMJF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|