C27H34O4 — CID 67724004
[4,4-dimethoxy-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-1-en-2-yl] benzoate (PubChem CID 67724004) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is [4,4-dimethoxy-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-1-en-2-yl] benzoate.
| Compound Name | [4,4-dimethoxy-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-1-en-2-yl] benzoate |
|---|---|
| PubChem CID | 67724004 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | [4,4-dimethoxy-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-1-en-2-yl] benzoate |
| SMILES | COC(CC(=Cc1ccc2c(c1)C(C)(C)CCC2(C)C)OC(=O)c1ccccc1)OC |
| InChI | InChI=1S/C27H34O4/c1-26(2)14-15-27(3,4)23-17-19(12-13-22(23)26)16-21(18-24(29-5)30-6)31-25(28)20-10-8-7-9-11-20/h7-13,16-17,24H,14-15,18H2,1-6H3 |
| InChIKey | MRHWXQPGFUGMFX-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|