C24H26O5 — CID 67623620
[3-hydroxy-3-(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoyl] benzoate (PubChem CID 67623620) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is [3-hydroxy-3-(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoyl] benzoate.
| Compound Name | [3-hydroxy-3-(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoyl] benzoate |
|---|---|
| PubChem CID | 67623620 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [3-hydroxy-3-(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoyl] benzoate |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(O)=CC(=O)OC(=O)c3ccccc3)c(O)cc21 |
| InChI | InChI=1S/C24H26O5/c1-23(2)10-11-24(3,4)18-13-19(25)16(12-17(18)23)20(26)14-21(27)29-22(28)15-8-6-5-7-9-15/h5-9,12-14,25-26H,10-11H2,1-4H3 |
| InChIKey | ONPHCLKLPCDYHP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|