C29H32O5 — CID 67808421
benzyl 2-hydroxy-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxymethoxy]benzoate (PubChem CID 67808421) has the molecular formula C29H32O5 and a molecular weight of 460.57 g/mol. Its IUPAC name is benzyl 2-hydroxy-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxymethoxy]benzoate.
| Compound Name | benzyl 2-hydroxy-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxymethoxy]benzoate |
|---|---|
| PubChem CID | 67808421 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | benzyl 2-hydroxy-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxymethoxy]benzoate |
| SMILES | CC1(C)CCC(C)(C)c2cc(OCOc3ccc(C(=O)OCc4ccccc4)c(O)c3)ccc21 |
| InChI | InChI=1S/C29H32O5/c1-28(2)14-15-29(3,4)25-16-21(11-13-24(25)28)33-19-34-22-10-12-23(26(30)17-22)27(31)32-18-20-8-6-5-7-9-20/h5-13,16-17,30H,14-15,18-19H2,1-4H3 |
| InChIKey | YOTDYMZWWMQISE-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|