C27H35NO5 — CID 11546969
butyl 2-hydroxy-4-[(2E)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoate (PubChem CID 11546969) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is butyl 2-hydroxy-4-[(2E)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoate.
| Compound Name | butyl 2-hydroxy-4-[(2E)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoate |
|---|---|
| PubChem CID | 11546969 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | butyl 2-hydroxy-4-[(2E)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoate |
| SMILES | CCCCOC(=O)c1ccc(OC/C(=N/O)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1O |
| InChI | InChI=1S/C27H35NO5/c1-6-7-14-32-25(30)20-10-9-19(16-24(20)29)33-17-23(28-31)18-8-11-21-22(15-18)27(4,5)13-12-26(21,2)3/h8-11,15-16,29,31H,6-7,12-14,17H2,1-5H3/b28-23- |
| InChIKey | NLKBBLQJCOLHFB-NFFVHWSESA-N |
| XLogP | 5.96 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|