C29H37NO10 — CID 11526937
2-hydroxy-4-[(2E)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]-6-[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzoic acid (PubChem CID 11526937) has the molecular formula C29H37NO10 and a molecular weight of 559.61 g/mol. Its IUPAC name is 2-hydroxy-4-[(2E)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]-6-[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzoic acid.
| Compound Name | 2-hydroxy-4-[(2E)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]-6-[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 11526937 |
| Molecular Formula | C29H37NO10 |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 2-hydroxy-4-[(2E)-2-hydroxyimino-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]-6-[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(/C(COc3cc(O)c(C(=O)O)c(C4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O)c3)=N\O)ccc21 |
| InChI | InChI=1S/C29H37NO10/c1-28(2)7-8-29(3,4)18-9-14(5-6-17(18)28)19(30-38)13-39-15-10-16(22(27(36)37)20(32)11-15)26-25(35)24(34)23(33)21(12-31)40-26/h5-6,9-11,21,23-26,31-35,38H,7-8,12-13H2,1-4H3,(H,36,37)/b30-19-/t21-,23+,24+,25-,26?/m1/s1 |
| InChIKey | DBGSKAYZOJJGDB-AYIMYTKCSA-N |
| XLogP | 2.21 |
| TPSA | 189.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|