C65H52N4O8 — CID 155072430
tetrabenzyl 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-cyclopenta[b]phenazine]-7,7',8,8'-tetracarboxylate (PubChem CID 155072430) has the molecular formula C65H52N4O8 and a molecular weight of 1017.15 g/mol. Its IUPAC name is tetrabenzyl 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-cyclopenta[b]phenazine]-7,7',8,8'-tetracarboxylate.
| Compound Name | tetrabenzyl 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-cyclopenta[b]phenazine]-7,7',8,8'-tetracarboxylate |
|---|---|
| PubChem CID | 155072430 |
| Molecular Formula | C65H52N4O8 |
| Molecular Weight | 1017.15 g/mol |
| Exact Mass | 1016.38 |
| IUPAC Name | tetrabenzyl 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-cyclopenta[b]phenazine]-7,7',8,8'-tetracarboxylate |
| SMILES | CC1(C)CC2(CC(C)(C)c3cc4nc5cc(C(=O)OCc6ccccc6)c(C(=O)OCc6ccccc6)cc5nc4cc32)c2cc3nc4cc(C(=O)OCc5ccccc5)c(C(=O)OCc5ccccc5)cc4nc3cc21 |
| InChI | InChI=1S/C65H52N4O8/c1-63(2)37-65(49-31-57-55(29-47(49)63)66-51-25-43(59(70)74-33-39-17-9-5-10-18-39)45(27-53(51)68-57)61(72)76-35-41-21-13-7-14-22-41)38-64(3,4)48-30-56-58(32-50(48)65)69-54-28-46(62(73)77-36-42-23-15-8-16-24-42)44(26-52(54)67-56)60(71)75-34-40-19-11-6-12-20-40/h5-32H,33-38H2,1-4H3 |
| InChIKey | DQPQHQUOGCJXQP-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 156.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.15 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|