C35H33FO3 — CID 87962436
benzoyl 4-[3-(2-fluorophenyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-2-methylbenzoate (PubChem CID 87962436) has the molecular formula C35H33FO3 and a molecular weight of 520.64 g/mol. Its IUPAC name is benzoyl 4-[3-(2-fluorophenyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-2-methylbenzoate.
| Compound Name | benzoyl 4-[3-(2-fluorophenyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 87962436 |
| Molecular Formula | C35H33FO3 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | benzoyl 4-[3-(2-fluorophenyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-2-methylbenzoate |
| SMILES | Cc1cc(-c2cc3c(cc2-c2ccccc2F)C(C)(C)CCC3(C)C)ccc1C(=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H33FO3/c1-22-19-24(15-16-25(22)33(38)39-32(37)23-11-7-6-8-12-23)27-20-29-30(35(4,5)18-17-34(29,2)3)21-28(27)26-13-9-10-14-31(26)36/h6-16,19-21H,17-18H2,1-5H3 |
| InChIKey | YGTHCFAMUDXASF-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|