C26H32N2O5 — CID 173299069
[[2-(1-hydroxypropoxyimino)acetyl]-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino] benzoate (PubChem CID 173299069) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is [[2-(1-hydroxypropoxyimino)acetyl]-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino] benzoate.
| Compound Name | [[2-(1-hydroxypropoxyimino)acetyl]-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino] benzoate |
|---|---|
| PubChem CID | 173299069 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [[2-(1-hydroxypropoxyimino)acetyl]-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino] benzoate |
| SMILES | CCC(O)ON=CC(=O)N(OC(=O)c1ccccc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H32N2O5/c1-6-23(30)32-27-17-22(29)28(33-24(31)18-10-8-7-9-11-18)19-12-13-20-21(16-19)26(4,5)15-14-25(20,2)3/h7-13,16-17,23,30H,6,14-15H2,1-5H3 |
| InChIKey | MBUWBGHSNMMOGT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|