C30H40N2O4 — CID 173299075
1-[[2-amino-2-oxo-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethylidene]amino]oxyheptyl benzoate (PubChem CID 173299075) has the molecular formula C30H40N2O4 and a molecular weight of 492.66 g/mol. Its IUPAC name is 1-[[2-amino-2-oxo-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethylidene]amino]oxyheptyl benzoate.
| Compound Name | 1-[[2-amino-2-oxo-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethylidene]amino]oxyheptyl benzoate |
|---|---|
| PubChem CID | 173299075 |
| Molecular Formula | C30H40N2O4 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | 1-[[2-amino-2-oxo-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethylidene]amino]oxyheptyl benzoate |
| SMILES | CCCCCCC(ON=C(C(N)=O)c1ccc2c(c1)C(C)(C)CCC2(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H40N2O4/c1-6-7-8-12-15-25(35-28(34)21-13-10-9-11-14-21)36-32-26(27(31)33)22-16-17-23-24(20-22)30(4,5)19-18-29(23,2)3/h9-11,13-14,16-17,20,25H,6-8,12,15,18-19H2,1-5H3,(H2,31,33) |
| InChIKey | UVWXTSQKSMHXNB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|