About [methyl(propyl)amino] benzoate
[methyl(propyl)amino] benzoate (PubChem CID 87875558) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is [methyl(propyl)amino] benzoate.
Molecular Properties
| Compound Name | [methyl(propyl)amino] benzoate |
| PubChem CID | 87875558 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | [methyl(propyl)amino] benzoate |
| SMILES | CCCN(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-3-9-12(2)14-11(13)10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3 |
| InChIKey | UKZBHIIXUHFGPX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [methyl(propyl)amino] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl(propyl)amino] benzoate?
The IUPAC name of [methyl(propyl)amino] benzoate (CID 87875558) is [methyl(propyl)amino] benzoate.
What is the SMILES notation for [methyl(propyl)amino] benzoate?
The canonical SMILES for [methyl(propyl)amino] benzoate is CCCN(C)OC(=O)c1ccccc1.
What is the InChIKey of [methyl(propyl)amino] benzoate?
The InChIKey is UKZBHIIXUHFGPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-3-9-12(2)14-11(13)10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3.
What are the key properties of [methyl(propyl)amino] benzoate?
[methyl(propyl)amino] benzoate has a molecular weight of 193.25 g/mol, XLogP of 2.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl(propyl)amino] benzoate is sourced from PubChem (CID 87875558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).