C26H24N2O3 — CID 177372379
4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)carbamoylamino]benzoic acid (PubChem CID 177372379) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)carbamoylamino]benzoic acid.
| Compound Name | 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 177372379 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)carbamoylamino]benzoic acid |
| SMILES | CC1(C)CC=C(c2ccccc2)c2cc(NC(=O)Nc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C26H24N2O3/c1-26(2)15-14-21(17-6-4-3-5-7-17)22-16-20(12-13-23(22)26)28-25(31)27-19-10-8-18(9-11-19)24(29)30/h3-14,16H,15H2,1-2H3,(H,29,30)(H2,27,28,31) |
| InChIKey | VVHNZDFHHDMKRJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |