C27H27NO2 — CID 54369153
4-[2-[4,4-dimethyl-1-(4-methylphenyl)-2,3-dihydroquinolin-7-yl]ethenyl]benzoic acid (PubChem CID 54369153) has the molecular formula C27H27NO2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-[2-[4,4-dimethyl-1-(4-methylphenyl)-2,3-dihydroquinolin-7-yl]ethenyl]benzoic acid.
| Compound Name | 4-[2-[4,4-dimethyl-1-(4-methylphenyl)-2,3-dihydroquinolin-7-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 54369153 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-[2-[4,4-dimethyl-1-(4-methylphenyl)-2,3-dihydroquinolin-7-yl]ethenyl]benzoic acid |
| SMILES | Cc1ccc(N2CCC(C)(C)c3ccc(C=Cc4ccc(C(=O)O)cc4)cc32)cc1 |
| InChI | InChI=1S/C27H27NO2/c1-19-4-13-23(14-5-19)28-17-16-27(2,3)24-15-10-21(18-25(24)28)7-6-20-8-11-22(12-9-20)26(29)30/h4-15,18H,16-17H2,1-3H3,(H,29,30) |
| InChIKey | URXPYYVXADVQJL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|