C25H24O6S — CID 87941272
2-[4-[(E)-3-(2,6-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-thiophen-2-ylphenoxy]-2-methylpropanoic acid (PubChem CID 87941272) has the molecular formula C25H24O6S and a molecular weight of 452.53 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2,6-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-thiophen-2-ylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(E)-3-(2,6-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-thiophen-2-ylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87941272 |
| Molecular Formula | C25H24O6S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-[4-[(E)-3-(2,6-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-thiophen-2-ylphenoxy]-2-methylpropanoic acid |
| SMILES | COc1cccc(OC)c1C(=O)/C=C/c1ccc(OC(C)(C)C(=O)O)c(-c2cccs2)c1 |
| InChI | InChI=1S/C25H24O6S/c1-25(2,24(27)28)31-19-13-11-16(15-17(19)22-9-6-14-32-22)10-12-18(26)23-20(29-3)7-5-8-21(23)30-4/h5-15H,1-4H3,(H,27,28)/b12-10+ |
| InChIKey | AUEVVRWDGAOJMR-ZRDIBKRKSA-N |
| XLogP | 5.57 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|