C32H44N2O2S — CID 18322154
ethyl 5-[6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyridazin-3-yl]pentanoate (PubChem CID 18322154) has the molecular formula C32H44N2O2S and a molecular weight of 520.78 g/mol. Its IUPAC name is ethyl 5-[6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyridazin-3-yl]pentanoate.
| Compound Name | ethyl 5-[6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyridazin-3-yl]pentanoate |
|---|---|
| PubChem CID | 18322154 |
| Molecular Formula | C32H44N2O2S |
| Molecular Weight | 520.78 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | ethyl 5-[6-[2-(4,4-diethyl-7-hexyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyridazin-3-yl]pentanoate |
| SMILES | CCCCCCc1cc2c(cc1C#Cc1ccc(CCCCC(=O)OCC)nn1)C(CC)(CC)CCS2 |
| InChI | InChI=1S/C32H44N2O2S/c1-5-9-10-11-14-25-24-30-29(32(6-2,7-3)21-22-37-30)23-26(25)17-18-28-20-19-27(33-34-28)15-12-13-16-31(35)36-8-4/h19-20,23-24H,5-16,21-22H2,1-4H3 |
| InChIKey | JVEYNSAQHHDHRE-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.78 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|