C28H36O4Si — CID 56979766
[4-(2-trimethylsilylethoxycarbonyl)phenyl] 5,5-dimethyl-8-propan-2-yl-6H-naphthalene-2-carboxylate (PubChem CID 56979766) has the molecular formula C28H36O4Si and a molecular weight of 464.68 g/mol. Its IUPAC name is [4-(2-trimethylsilylethoxycarbonyl)phenyl] 5,5-dimethyl-8-propan-2-yl-6H-naphthalene-2-carboxylate.
| Compound Name | [4-(2-trimethylsilylethoxycarbonyl)phenyl] 5,5-dimethyl-8-propan-2-yl-6H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 56979766 |
| Molecular Formula | C28H36O4Si |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [4-(2-trimethylsilylethoxycarbonyl)phenyl] 5,5-dimethyl-8-propan-2-yl-6H-naphthalene-2-carboxylate |
| SMILES | CC(C)C1=CCC(C)(C)c2ccc(C(=O)Oc3ccc(C(=O)OCC[Si](C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C28H36O4Si/c1-19(2)23-14-15-28(3,4)25-13-10-21(18-24(23)25)27(30)32-22-11-8-20(9-12-22)26(29)31-16-17-33(5,6)7/h8-14,18-19H,15-17H2,1-7H3 |
| InChIKey | QGPIVYGWJQVQIL-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|