C25H32O5Si — CID 22571575
[4-(2-trimethylsilylethoxycarbonyl)phenyl] 8-hydroxy-5,5-dimethyl-7,8-dihydro-6H-naphthalene-2-carboxylate (PubChem CID 22571575) has the molecular formula C25H32O5Si and a molecular weight of 440.61 g/mol. Its IUPAC name is [4-(2-trimethylsilylethoxycarbonyl)phenyl] 8-hydroxy-5,5-dimethyl-7,8-dihydro-6H-naphthalene-2-carboxylate.
| Compound Name | [4-(2-trimethylsilylethoxycarbonyl)phenyl] 8-hydroxy-5,5-dimethyl-7,8-dihydro-6H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 22571575 |
| Molecular Formula | C25H32O5Si |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [4-(2-trimethylsilylethoxycarbonyl)phenyl] 8-hydroxy-5,5-dimethyl-7,8-dihydro-6H-naphthalene-2-carboxylate |
| SMILES | CC1(C)CCC(O)c2cc(C(=O)Oc3ccc(C(=O)OCC[Si](C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C25H32O5Si/c1-25(2)13-12-22(26)20-16-18(8-11-21(20)25)24(28)30-19-9-6-17(7-10-19)23(27)29-14-15-31(3,4)5/h6-11,16,22,26H,12-15H2,1-5H3 |
| InChIKey | NAEYHEJFIRMVKL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|