C20H19O5- — CID 22641982
4-(8-hydroxy-5,5-dimethyl-7,8-dihydro-6H-naphthalene-2-carbonyl)oxybenzoate (PubChem CID 22641982) has the molecular formula C20H19O5- and a molecular weight of 339.37 g/mol. Its IUPAC name is 4-(8-hydroxy-5,5-dimethyl-7,8-dihydro-6H-naphthalene-2-carbonyl)oxybenzoate.
| Compound Name | 4-(8-hydroxy-5,5-dimethyl-7,8-dihydro-6H-naphthalene-2-carbonyl)oxybenzoate |
|---|---|
| PubChem CID | 22641982 |
| Molecular Formula | C20H19O5- |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-(8-hydroxy-5,5-dimethyl-7,8-dihydro-6H-naphthalene-2-carbonyl)oxybenzoate |
| SMILES | CC1(C)CCC(O)c2cc(C(=O)Oc3ccc(C(=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C20H20O5/c1-20(2)10-9-17(21)15-11-13(5-8-16(15)20)19(24)25-14-6-3-12(4-7-14)18(22)23/h3-8,11,17,21H,9-10H2,1-2H3,(H,22,23)/p-1 |
| InChIKey | WZBUOWIKHSVSKE-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|