C22H23NO3 — CID 22872085
phenyl (4aR,10bR)-4,10b-dimethyl-3-oxo-2,4a,5,6-tetrahydro-1H-benzo[f]quinoline-8-carboxylate (PubChem CID 22872085) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is phenyl (4aR,10bR)-4,10b-dimethyl-3-oxo-2,4a,5,6-tetrahydro-1H-benzo[f]quinoline-8-carboxylate.
| Compound Name | phenyl (4aR,10bR)-4,10b-dimethyl-3-oxo-2,4a,5,6-tetrahydro-1H-benzo[f]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 22872085 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | phenyl (4aR,10bR)-4,10b-dimethyl-3-oxo-2,4a,5,6-tetrahydro-1H-benzo[f]quinoline-8-carboxylate |
| SMILES | CN1C(=O)CC[C@]2(C)c3ccc(C(=O)Oc4ccccc4)cc3CC[C@@H]12 |
| InChI | InChI=1S/C22H23NO3/c1-22-13-12-20(24)23(2)19(22)11-9-15-14-16(8-10-18(15)22)21(25)26-17-6-4-3-5-7-17/h3-8,10,14,19H,9,11-13H2,1-2H3/t19-,22-/m1/s1 |
| InChIKey | DYJKKISZLFBLDG-DENIHFKCSA-N |
| XLogP | 3.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|