C21H24N2O — CID 54132714
(10bR)-8-(3-aminophenyl)-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one (PubChem CID 54132714) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is (10bR)-8-(3-aminophenyl)-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one.
| Compound Name | (10bR)-8-(3-aminophenyl)-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 54132714 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (10bR)-8-(3-aminophenyl)-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
| SMILES | CN1C(=O)CC[C@]2(C)c3ccc(-c4cccc(N)c4)cc3CCC12 |
| InChI | InChI=1S/C21H24N2O/c1-21-11-10-20(24)23(2)19(21)9-7-16-12-15(6-8-18(16)21)14-4-3-5-17(22)13-14/h3-6,8,12-13,19H,7,9-11,22H2,1-2H3/t19?,21-/m1/s1 |
| InChIKey | QOINSTVRAPWGTE-VGAJERRHSA-N |
| XLogP | 3.76 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|