C29H27NO — CID 54014229
(4aR,10bR)-8-anthracen-9-yl-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one (PubChem CID 54014229) has the molecular formula C29H27NO and a molecular weight of 405.54 g/mol. Its IUPAC name is (4aR,10bR)-8-anthracen-9-yl-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one.
| Compound Name | (4aR,10bR)-8-anthracen-9-yl-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 54014229 |
| Molecular Formula | C29H27NO |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (4aR,10bR)-8-anthracen-9-yl-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
| SMILES | CN1C(=O)CC[C@]2(C)c3ccc(-c4c5ccccc5cc5ccccc45)cc3CC[C@@H]12 |
| InChI | InChI=1S/C29H27NO/c1-29-16-15-27(31)30(2)26(29)14-12-21-18-22(11-13-25(21)29)28-23-9-5-3-7-19(23)17-20-8-4-6-10-24(20)28/h3-11,13,17-18,26H,12,14-16H2,1-2H3/t26-,29-/m1/s1 |
| InChIKey | KUMUGRLFZNNFKP-GGXMVOPNSA-N |
| XLogP | 6.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|