C28H40O2 — CID 142116195
ethane;methyl 4-[(E)-1-(5,5,8-trimethyl-7,8-dihydro-6H-naphthalen-2-yl)prop-1-en-2-yl]benzoate (PubChem CID 142116195) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is ethane;methyl 4-[(E)-1-(5,5,8-trimethyl-7,8-dihydro-6H-naphthalen-2-yl)prop-1-en-2-yl]benzoate.
| Compound Name | ethane;methyl 4-[(E)-1-(5,5,8-trimethyl-7,8-dihydro-6H-naphthalen-2-yl)prop-1-en-2-yl]benzoate |
|---|---|
| PubChem CID | 142116195 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | ethane;methyl 4-[(E)-1-(5,5,8-trimethyl-7,8-dihydro-6H-naphthalen-2-yl)prop-1-en-2-yl]benzoate |
| SMILES | CC.CC.COC(=O)c1ccc(/C(C)=C/c2ccc3c(c2)C(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C24H28O2.2C2H6/c1-16-12-13-24(3,4)22-11-6-18(15-21(16)22)14-17(2)19-7-9-20(10-8-19)23(25)26-5;2*1-2/h6-11,14-16H,12-13H2,1-5H3;2*1-2H3/b17-14+;; |
| InChIKey | KQYCKXAQOHJKIL-WTLOABTRSA-N |
| XLogP | 8.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|