C28H36O2 — CID 54044368
propyl 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate (PubChem CID 54044368) has the molecular formula C28H36O2 and a molecular weight of 404.59 g/mol. Its IUPAC name is propyl 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate.
| Compound Name | propyl 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 54044368 |
| Molecular Formula | C28H36O2 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | propyl 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate |
| SMILES | CCCOC(=O)c1ccc(C=C(C)c2cc3c(cc2CC)C(C)(C)CC3(C)C)cc1 |
| InChI | InChI=1S/C28H36O2/c1-8-14-30-26(29)22-12-10-20(11-13-22)15-19(3)23-17-25-24(16-21(23)9-2)27(4,5)18-28(25,6)7/h10-13,15-17H,8-9,14,18H2,1-7H3 |
| InChIKey | LONJBRWZESDUCH-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|