C37H49NO3 — CID 70456216
4-aminophenol;4-[2-(1,1,3,3-tetramethyl-6-octyl-2H-inden-5-yl)prop-1-enyl]benzoic acid (PubChem CID 70456216) has the molecular formula C37H49NO3 and a molecular weight of 555.80 g/mol. Its IUPAC name is 4-aminophenol;4-[2-(1,1,3,3-tetramethyl-6-octyl-2H-inden-5-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-aminophenol;4-[2-(1,1,3,3-tetramethyl-6-octyl-2H-inden-5-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 70456216 |
| Molecular Formula | C37H49NO3 |
| Molecular Weight | 555.80 g/mol |
| Exact Mass | 555.37 |
| IUPAC Name | 4-aminophenol;4-[2-(1,1,3,3-tetramethyl-6-octyl-2H-inden-5-yl)prop-1-enyl]benzoic acid |
| SMILES | CCCCCCCCc1cc2c(cc1C(C)=Cc1ccc(C(=O)O)cc1)C(C)(C)CC2(C)C.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C31H42O2.C6H7NO/c1-7-8-9-10-11-12-13-25-19-27-28(31(5,6)21-30(27,3)4)20-26(25)22(2)18-23-14-16-24(17-15-23)29(32)33;7-5-1-3-6(8)4-2-5/h14-20H,7-13,21H2,1-6H3,(H,32,33);1-4,8H,7H2 |
| InChIKey | ROJDJYAKXBKGLI-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.80 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|