C24H28O6 — CID 10501826
(4-ethoxycarbonylphenyl) 6-methoxy-1,1,4,4-tetramethyl-3H-isochromene-7-carboxylate (PubChem CID 10501826) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is (4-ethoxycarbonylphenyl) 6-methoxy-1,1,4,4-tetramethyl-3H-isochromene-7-carboxylate.
| Compound Name | (4-ethoxycarbonylphenyl) 6-methoxy-1,1,4,4-tetramethyl-3H-isochromene-7-carboxylate |
|---|---|
| PubChem CID | 10501826 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (4-ethoxycarbonylphenyl) 6-methoxy-1,1,4,4-tetramethyl-3H-isochromene-7-carboxylate |
| SMILES | CCOC(=O)c1ccc(OC(=O)c2cc3c(cc2OC)C(C)(C)COC3(C)C)cc1 |
| InChI | InChI=1S/C24H28O6/c1-7-28-21(25)15-8-10-16(11-9-15)30-22(26)17-12-19-18(13-20(17)27-6)23(2,3)14-29-24(19,4)5/h8-13H,7,14H2,1-6H3 |
| InChIKey | WWVYNOFKTKQPGJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|