C25H26O6 — CID 18793585
2-O-(4-ethoxycarbonylphenyl) 1-O-ethyl 5,5-dimethyl-6H-naphthalene-1,2-dicarboxylate (PubChem CID 18793585) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-O-(4-ethoxycarbonylphenyl) 1-O-ethyl 5,5-dimethyl-6H-naphthalene-1,2-dicarboxylate.
| Compound Name | 2-O-(4-ethoxycarbonylphenyl) 1-O-ethyl 5,5-dimethyl-6H-naphthalene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 18793585 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-O-(4-ethoxycarbonylphenyl) 1-O-ethyl 5,5-dimethyl-6H-naphthalene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(OC(=O)c2ccc3c(c2C(=O)OCC)C=CCC3(C)C)cc1 |
| InChI | InChI=1S/C25H26O6/c1-5-29-22(26)16-9-11-17(12-10-16)31-23(27)19-13-14-20-18(8-7-15-25(20,3)4)21(19)24(28)30-6-2/h7-14H,5-6,15H2,1-4H3 |
| InChIKey | RIHRPZZKVHJBAA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|