C23H30O3 — CID 88785211
ethyl (2E)-7-(7-methoxy-3,3-dimethyl-1,2-dihydroinden-5-yl)-3-methylocta-2,4,6-trienoate (PubChem CID 88785211) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is ethyl (2E)-7-(7-methoxy-3,3-dimethyl-1,2-dihydroinden-5-yl)-3-methylocta-2,4,6-trienoate.
| Compound Name | ethyl (2E)-7-(7-methoxy-3,3-dimethyl-1,2-dihydroinden-5-yl)-3-methylocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 88785211 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | ethyl (2E)-7-(7-methoxy-3,3-dimethyl-1,2-dihydroinden-5-yl)-3-methylocta-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C(\C)C=CC=C(C)c1cc(OC)c2c(c1)C(C)(C)CC2 |
| InChI | InChI=1S/C23H30O3/c1-7-26-22(24)13-16(2)9-8-10-17(3)18-14-20-19(21(15-18)25-6)11-12-23(20,4)5/h8-10,13-15H,7,11-12H2,1-6H3/b9-8?,16-13+,17-10? |
| InChIKey | JJTHTRAUDXDIEE-UKTWAAPDSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|