C27H32N2 — CID 122384059
2-[7-(cyanomethyl)-9,9-dipentylfluoren-2-yl]acetonitrile (PubChem CID 122384059) has the molecular formula C27H32N2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-[7-(cyanomethyl)-9,9-dipentylfluoren-2-yl]acetonitrile.
| Compound Name | 2-[7-(cyanomethyl)-9,9-dipentylfluoren-2-yl]acetonitrile |
|---|---|
| PubChem CID | 122384059 |
| Molecular Formula | C27H32N2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 2-[7-(cyanomethyl)-9,9-dipentylfluoren-2-yl]acetonitrile |
| SMILES | CCCCCC1(CCCCC)c2cc(CC#N)ccc2-c2ccc(CC#N)cc21 |
| InChI | InChI=1S/C27H32N2/c1-3-5-7-15-27(16-8-6-4-2)25-19-21(13-17-28)9-11-23(25)24-12-10-22(14-18-29)20-26(24)27/h9-12,19-20H,3-8,13-16H2,1-2H3 |
| InChIKey | SZQPILZDWZAOHA-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|