C29H38O4 — CID 170886641
2-[7-(carboxymethyl)-9,9-dihexylfluoren-2-yl]acetic acid (PubChem CID 170886641) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is 2-[7-(carboxymethyl)-9,9-dihexylfluoren-2-yl]acetic acid.
| Compound Name | 2-[7-(carboxymethyl)-9,9-dihexylfluoren-2-yl]acetic acid |
|---|---|
| PubChem CID | 170886641 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 2-[7-(carboxymethyl)-9,9-dihexylfluoren-2-yl]acetic acid |
| SMILES | CCCCCCC1(CCCCCC)c2cc(CC(=O)O)ccc2-c2ccc(CC(=O)O)cc21 |
| InChI | InChI=1S/C29H38O4/c1-3-5-7-9-15-29(16-10-8-6-4-2)25-17-21(19-27(30)31)11-13-23(25)24-14-12-22(18-26(24)29)20-28(32)33/h11-14,17-18H,3-10,15-16,19-20H2,1-2H3,(H,30,31)(H,32,33) |
| InChIKey | KIELOJSHUSOYPF-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|