C30H29F7 — CID 88552688
1,8,9,9,10,10-hexafluoro-2-[2-(2-fluoro-4-pentylphenyl)ethyl]-7-propylphenanthrene (PubChem CID 88552688) has the molecular formula C30H29F7 and a molecular weight of 522.55 g/mol. Its IUPAC name is 1,8,9,9,10,10-hexafluoro-2-[2-(2-fluoro-4-pentylphenyl)ethyl]-7-propylphenanthrene.
| Compound Name | 1,8,9,9,10,10-hexafluoro-2-[2-(2-fluoro-4-pentylphenyl)ethyl]-7-propylphenanthrene |
|---|---|
| PubChem CID | 88552688 |
| Molecular Formula | C30H29F7 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 1,8,9,9,10,10-hexafluoro-2-[2-(2-fluoro-4-pentylphenyl)ethyl]-7-propylphenanthrene |
| SMILES | CCCCCc1ccc(CCc2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(CCC)c2F)c(F)c1 |
| InChI | InChI=1S/C30H29F7/c1-3-5-6-8-18-9-10-19(24(31)17-18)11-12-21-14-16-23-22-15-13-20(7-4-2)27(32)25(22)29(34,35)30(36,37)26(23)28(21)33/h9-10,13-17H,3-8,11-12H2,1-2H3 |
| InChIKey | GFIZGQSMTDUMKN-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|