C28H25F7 — CID 88552672
1,8,9,9,10,10-hexafluoro-2-(3-fluoro-4-pentylphenyl)-7-propylphenanthrene (PubChem CID 88552672) has the molecular formula C28H25F7 and a molecular weight of 494.49 g/mol. Its IUPAC name is 1,8,9,9,10,10-hexafluoro-2-(3-fluoro-4-pentylphenyl)-7-propylphenanthrene.
| Compound Name | 1,8,9,9,10,10-hexafluoro-2-(3-fluoro-4-pentylphenyl)-7-propylphenanthrene |
|---|---|
| PubChem CID | 88552672 |
| Molecular Formula | C28H25F7 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 1,8,9,9,10,10-hexafluoro-2-(3-fluoro-4-pentylphenyl)-7-propylphenanthrene |
| SMILES | CCCCCc1ccc(-c2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(CCC)c2F)cc1F |
| InChI | InChI=1S/C28H25F7/c1-3-5-6-8-16-9-10-18(15-22(16)29)19-13-14-21-20-12-11-17(7-4-2)25(30)23(20)27(32,33)28(34,35)24(21)26(19)31/h9-15H,3-8H2,1-2H3 |
| InChIKey | ORVNGOYVARIJNU-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|