C29H26F8O — CID 88552760
2-[(2,3-difluoro-4-pentylphenyl)methoxy]-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene (PubChem CID 88552760) has the molecular formula C29H26F8O and a molecular weight of 542.51 g/mol. Its IUPAC name is 2-[(2,3-difluoro-4-pentylphenyl)methoxy]-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene.
| Compound Name | 2-[(2,3-difluoro-4-pentylphenyl)methoxy]-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene |
|---|---|
| PubChem CID | 88552760 |
| Molecular Formula | C29H26F8O |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 2-[(2,3-difluoro-4-pentylphenyl)methoxy]-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene |
| SMILES | CCCCCc1ccc(COc2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(CCC)c2F)c(F)c1F |
| InChI | InChI=1S/C29H26F8O/c1-3-5-6-8-17-9-10-18(26(32)25(17)31)15-38-21-14-13-20-19-12-11-16(7-4-2)24(30)22(19)28(34,35)29(36,37)23(20)27(21)33/h9-14H,3-8,15H2,1-2H3 |
| InChIKey | DGQLYOQPXMSTFC-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|