C27H21F7O2 — CID 88552678
2-[(4-but-3-enyl-2-fluorophenoxy)methyl]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene (PubChem CID 88552678) has the molecular formula C27H21F7O2 and a molecular weight of 510.45 g/mol. Its IUPAC name is 2-[(4-but-3-enyl-2-fluorophenoxy)methyl]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene.
| Compound Name | 2-[(4-but-3-enyl-2-fluorophenoxy)methyl]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene |
|---|---|
| PubChem CID | 88552678 |
| Molecular Formula | C27H21F7O2 |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-[(4-but-3-enyl-2-fluorophenoxy)methyl]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene |
| SMILES | C=CCCc1ccc(OCc2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(OCC)c2F)c(F)c1 |
| InChI | InChI=1S/C27H21F7O2/c1-3-5-6-15-7-11-20(19(28)13-15)36-14-16-8-9-17-18-10-12-21(35-4-2)25(30)23(18)27(33,34)26(31,32)22(17)24(16)29/h3,7-13H,1,4-6,14H2,2H3 |
| InChIKey | AQDYQGLDLDIUCT-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|