C26H20F8O2 — CID 88552783
2-[difluoro-(4-propylphenyl)methoxy]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene (PubChem CID 88552783) has the molecular formula C26H20F8O2 and a molecular weight of 516.43 g/mol. Its IUPAC name is 2-[difluoro-(4-propylphenyl)methoxy]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene.
| Compound Name | 2-[difluoro-(4-propylphenyl)methoxy]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene |
|---|---|
| PubChem CID | 88552783 |
| Molecular Formula | C26H20F8O2 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 2-[difluoro-(4-propylphenyl)methoxy]-7-ethoxy-1,8,9,9,10,10-hexafluorophenanthrene |
| SMILES | CCCc1ccc(C(F)(F)Oc2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(OCC)c2F)cc1 |
| InChI | InChI=1S/C26H20F8O2/c1-3-5-14-6-8-15(9-7-14)26(33,34)36-19-13-11-17-16-10-12-18(35-4-2)22(27)20(16)24(29,30)25(31,32)21(17)23(19)28/h6-13H,3-5H2,1-2H3 |
| InChIKey | CIOZJKXSMBVHKW-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|