C29H24F8O — CID 88552789
2-[1-(4-but-3-enyl-3-fluorophenyl)-1-fluoroethoxy]-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene (PubChem CID 88552789) has the molecular formula C29H24F8O and a molecular weight of 540.49 g/mol. Its IUPAC name is 2-[1-(4-but-3-enyl-3-fluorophenyl)-1-fluoroethoxy]-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene.
| Compound Name | 2-[1-(4-but-3-enyl-3-fluorophenyl)-1-fluoroethoxy]-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene |
|---|---|
| PubChem CID | 88552789 |
| Molecular Formula | C29H24F8O |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 2-[1-(4-but-3-enyl-3-fluorophenyl)-1-fluoroethoxy]-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene |
| SMILES | C=CCCc1ccc(C(C)(F)Oc2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(CCC)c2F)cc1F |
| InChI | InChI=1S/C29H24F8O/c1-4-6-8-16-9-11-18(15-21(16)30)27(3,33)38-22-14-13-20-19-12-10-17(7-5-2)25(31)23(19)28(34,35)29(36,37)24(20)26(22)32/h4,9-15H,1,5-8H2,2-3H3 |
| InChIKey | SJRKBZMZWPNISP-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|