C21H22F8O — CID 121476229
1-[3-(2,3-difluoro-4-propylphenoxy)-3,3-difluoropropyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene (PubChem CID 121476229) has the molecular formula C21H22F8O and a molecular weight of 442.39 g/mol. Its IUPAC name is 1-[3-(2,3-difluoro-4-propylphenoxy)-3,3-difluoropropyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene.
| Compound Name | 1-[3-(2,3-difluoro-4-propylphenoxy)-3,3-difluoropropyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476229 |
| Molecular Formula | C21H22F8O |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-[3-(2,3-difluoro-4-propylphenoxy)-3,3-difluoropropyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(CCC(F)(F)Oc2ccc(CCC)c(F)c2F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C21H22F8O/c1-3-5-13-7-10-16(18(23)17(13)22)30-19(24,25)12-11-15-9-8-14(6-4-2)20(26,27)21(15,28)29/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | JKROVCMBOZSJDF-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|