C28H30F4O2 — CID 58995783
1-butoxy-4-[3,3-difluoro-3-[4-(4-propylphenyl)phenoxy]propyl]-2,3-difluorobenzene (PubChem CID 58995783) has the molecular formula C28H30F4O2 and a molecular weight of 474.54 g/mol. Its IUPAC name is 1-butoxy-4-[3,3-difluoro-3-[4-(4-propylphenyl)phenoxy]propyl]-2,3-difluorobenzene.
| Compound Name | 1-butoxy-4-[3,3-difluoro-3-[4-(4-propylphenyl)phenoxy]propyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 58995783 |
| Molecular Formula | C28H30F4O2 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 1-butoxy-4-[3,3-difluoro-3-[4-(4-propylphenyl)phenoxy]propyl]-2,3-difluorobenzene |
| SMILES | CCCCOc1ccc(CCC(F)(F)Oc2ccc(-c3ccc(CCC)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C28H30F4O2/c1-3-5-19-33-25-16-13-23(26(29)27(25)30)17-18-28(31,32)34-24-14-11-22(12-15-24)21-9-7-20(6-4-2)8-10-21/h7-16H,3-6,17-19H2,1-2H3 |
| InChIKey | ORVAJDGXVLGFGU-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|