C27H21F7 — CID 88552650
2-(4-but-3-enyl-2-fluorophenyl)-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene (PubChem CID 88552650) has the molecular formula C27H21F7 and a molecular weight of 478.45 g/mol. Its IUPAC name is 2-(4-but-3-enyl-2-fluorophenyl)-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene.
| Compound Name | 2-(4-but-3-enyl-2-fluorophenyl)-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene |
|---|---|
| PubChem CID | 88552650 |
| Molecular Formula | C27H21F7 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-(4-but-3-enyl-2-fluorophenyl)-1,8,9,9,10,10-hexafluoro-7-propylphenanthrene |
| SMILES | C=CCCc1ccc(-c2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(CCC)c2F)c(F)c1 |
| InChI | InChI=1S/C27H21F7/c1-3-5-7-15-8-10-17(21(28)14-15)20-13-12-19-18-11-9-16(6-4-2)24(29)22(18)26(31,32)27(33,34)23(19)25(20)30/h3,8-14H,1,4-7H2,2H3 |
| InChIKey | OJCXTGJWQDWELL-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|