C20H20F4O2 — CID 58687488
8-ethoxy-4,6,6,7-tetrafluoro-3-pentylbenzo[c]chromene (PubChem CID 58687488) has the molecular formula C20H20F4O2 and a molecular weight of 368.37 g/mol. Its IUPAC name is 8-ethoxy-4,6,6,7-tetrafluoro-3-pentylbenzo[c]chromene.
| Compound Name | 8-ethoxy-4,6,6,7-tetrafluoro-3-pentylbenzo[c]chromene |
|---|---|
| PubChem CID | 58687488 |
| Molecular Formula | C20H20F4O2 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 8-ethoxy-4,6,6,7-tetrafluoro-3-pentylbenzo[c]chromene |
| SMILES | CCCCCc1ccc2c(c1F)OC(F)(F)c1c-2ccc(OCC)c1F |
| InChI | InChI=1S/C20H20F4O2/c1-3-5-6-7-12-8-9-14-13-10-11-15(25-4-2)18(22)16(13)20(23,24)26-19(14)17(12)21/h8-11H,3-7H2,1-2H3 |
| InChIKey | JTPHMYZEINFFSE-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|