C26H25F3O — CID 141230093
4,6,6-trifluoro-3-hexyl-8-(4-methylphenyl)benzo[c]chromene (PubChem CID 141230093) has the molecular formula C26H25F3O and a molecular weight of 410.48 g/mol. Its IUPAC name is 4,6,6-trifluoro-3-hexyl-8-(4-methylphenyl)benzo[c]chromene.
| Compound Name | 4,6,6-trifluoro-3-hexyl-8-(4-methylphenyl)benzo[c]chromene |
|---|---|
| PubChem CID | 141230093 |
| Molecular Formula | C26H25F3O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 4,6,6-trifluoro-3-hexyl-8-(4-methylphenyl)benzo[c]chromene |
| SMILES | CCCCCCc1ccc2c(c1F)OC(F)(F)c1cc(-c3ccc(C)cc3)ccc1-2 |
| InChI | InChI=1S/C26H25F3O/c1-3-4-5-6-7-19-12-15-22-21-14-13-20(18-10-8-17(2)9-11-18)16-23(21)26(28,29)30-25(22)24(19)27/h8-16H,3-7H2,1-2H3 |
| InChIKey | JJNYQKOXUXOCSZ-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|