C22H23F3O — CID 141494647
3-ethyl-4,6,6-trifluoro-8-(4-methylcyclohexyl)benzo[c]chromene (PubChem CID 141494647) has the molecular formula C22H23F3O and a molecular weight of 360.42 g/mol. Its IUPAC name is 3-ethyl-4,6,6-trifluoro-8-(4-methylcyclohexyl)benzo[c]chromene.
| Compound Name | 3-ethyl-4,6,6-trifluoro-8-(4-methylcyclohexyl)benzo[c]chromene |
|---|---|
| PubChem CID | 141494647 |
| Molecular Formula | C22H23F3O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 3-ethyl-4,6,6-trifluoro-8-(4-methylcyclohexyl)benzo[c]chromene |
| SMILES | CCc1ccc2c(c1F)OC(F)(F)c1cc(C3CCC(C)CC3)ccc1-2 |
| InChI | InChI=1S/C22H23F3O/c1-3-14-8-11-18-17-10-9-16(15-6-4-13(2)5-7-15)12-19(17)22(24,25)26-21(18)20(14)23/h8-13,15H,3-7H2,1-2H3 |
| InChIKey | LFXOVANAGLCCSK-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |