C28H29F3O — CID 141230061
3-butyl-4,6,6-trifluoro-8-(4-pentylphenyl)benzo[c]chromene (PubChem CID 141230061) has the molecular formula C28H29F3O and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-butyl-4,6,6-trifluoro-8-(4-pentylphenyl)benzo[c]chromene.
| Compound Name | 3-butyl-4,6,6-trifluoro-8-(4-pentylphenyl)benzo[c]chromene |
|---|---|
| PubChem CID | 141230061 |
| Molecular Formula | C28H29F3O |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 3-butyl-4,6,6-trifluoro-8-(4-pentylphenyl)benzo[c]chromene |
| SMILES | CCCCCc1ccc(-c2ccc3c(c2)C(F)(F)Oc2c-3ccc(CCCC)c2F)cc1 |
| InChI | InChI=1S/C28H29F3O/c1-3-5-7-8-19-10-12-20(13-11-19)22-15-16-23-24-17-14-21(9-6-4-2)26(29)27(24)32-28(30,31)25(23)18-22/h10-18H,3-9H2,1-2H3 |
| InChIKey | VJBVNPKMQCLFLB-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|