C30H34F6O2 — CID 118583518
6-[2-(7-butoxy-1,8,9,9,10,10-hexafluorophenanthren-2-yl)ethyl]-3-pentyl-3,4-dihydro-2H-pyran (PubChem CID 118583518) has the molecular formula C30H34F6O2 and a molecular weight of 540.59 g/mol. Its IUPAC name is 6-[2-(7-butoxy-1,8,9,9,10,10-hexafluorophenanthren-2-yl)ethyl]-3-pentyl-3,4-dihydro-2H-pyran.
| Compound Name | 6-[2-(7-butoxy-1,8,9,9,10,10-hexafluorophenanthren-2-yl)ethyl]-3-pentyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118583518 |
| Molecular Formula | C30H34F6O2 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 6-[2-(7-butoxy-1,8,9,9,10,10-hexafluorophenanthren-2-yl)ethyl]-3-pentyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCCC1CC=C(CCc2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(OCCCC)c2F)OC1 |
| InChI | InChI=1S/C30H34F6O2/c1-3-5-7-8-19-9-12-21(38-18-19)13-10-20-11-14-22-23-15-16-24(37-17-6-4-2)28(32)26(23)30(35,36)29(33,34)25(22)27(20)31/h11-12,14-16,19H,3-10,13,17-18H2,1-2H3 |
| InChIKey | HAGTXWLVPSZWBK-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|