C29H43F3O2 — CID 134190957
3-[2-(4-butylcyclohexyl)ethyl]-1,1,8-trifluoro-7-octoxyisochromene (PubChem CID 134190957) has the molecular formula C29H43F3O2 and a molecular weight of 480.66 g/mol. Its IUPAC name is 3-[2-(4-butylcyclohexyl)ethyl]-1,1,8-trifluoro-7-octoxyisochromene.
| Compound Name | 3-[2-(4-butylcyclohexyl)ethyl]-1,1,8-trifluoro-7-octoxyisochromene |
|---|---|
| PubChem CID | 134190957 |
| Molecular Formula | C29H43F3O2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 3-[2-(4-butylcyclohexyl)ethyl]-1,1,8-trifluoro-7-octoxyisochromene |
| SMILES | CCCCCCCCOc1ccc2c(c1F)C(F)(F)OC(CCC1CCC(CCCC)CC1)=C2 |
| InChI | InChI=1S/C29H43F3O2/c1-3-5-7-8-9-10-20-33-26-19-17-24-21-25(34-29(31,32)27(24)28(26)30)18-16-23-14-12-22(13-15-23)11-6-4-2/h17,19,21-23H,3-16,18,20H2,1-2H3 |
| InChIKey | GHKPFXXGAICPIY-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|