C23H31F3O2 — CID 134190689
7-but-3-enoxy-3-decyl-1,1,8-trifluoroisochromene (PubChem CID 134190689) has the molecular formula C23H31F3O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 7-but-3-enoxy-3-decyl-1,1,8-trifluoroisochromene.
| Compound Name | 7-but-3-enoxy-3-decyl-1,1,8-trifluoroisochromene |
|---|---|
| PubChem CID | 134190689 |
| Molecular Formula | C23H31F3O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 7-but-3-enoxy-3-decyl-1,1,8-trifluoroisochromene |
| SMILES | C=CCCOc1ccc2c(c1F)C(F)(F)OC(CCCCCCCCCC)=C2 |
| InChI | InChI=1S/C23H31F3O2/c1-3-5-7-8-9-10-11-12-13-19-17-18-14-15-20(27-16-6-4-2)22(24)21(18)23(25,26)28-19/h4,14-15,17H,2-3,5-13,16H2,1H3 |
| InChIKey | NXFKHTVPCDMZAM-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|