C27H26F6O — CID 118583560
3-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)-6-[(E)-pent-3-enyl]-3,4-dihydro-2H-pyran (PubChem CID 118583560) has the molecular formula C27H26F6O and a molecular weight of 480.49 g/mol. Its IUPAC name is 3-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)-6-[(E)-pent-3-enyl]-3,4-dihydro-2H-pyran.
| Compound Name | 3-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)-6-[(E)-pent-3-enyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118583560 |
| Molecular Formula | C27H26F6O |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 3-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)-6-[(E)-pent-3-enyl]-3,4-dihydro-2H-pyran |
| SMILES | C/C=C/CCC1=CCC(c2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(CCC)c2F)CO1 |
| InChI | InChI=1S/C27H26F6O/c1-3-5-6-8-18-11-9-17(15-34-18)19-13-14-21-20-12-10-16(7-4-2)24(28)22(20)26(30,31)27(32,33)23(21)25(19)29/h3,5,10-14,17H,4,6-9,15H2,1-2H3/b5-3+ |
| InChIKey | XKQNNVPMVLAGRS-HWKANZROSA-N |
| XLogP | 8.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|